| Identification | |
| Name: | 2H-Indazole,7-bromo-2-methyl- |
| Synonyms: | 7-BROMO-2-METHYL-2H-INDAZOLE |
| CAS: | 701910-14-7 |
| Molecular Formula: | C8H7 Br N2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H7BrN2/c1-11-5-6-3-2-4-7(9)8(6)10-11/h2-5H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.6 g/cm3 |
| Refractive index: | 1.663 |
| Specification: |
The cas register number of 7-Bromo-2-methyl-2H-indazole is 701910-14-7. It also can be called as 2H-Indazole,7-bromo-2-methyl- and the IUPAC Name about this chemical is 7-bromo-2-methylindazole. It belongs to the following product categories, such as Indazole, Organohalides and so on. Physical properties about 701910-14-7 are: (1)ACD/LogP: 2.58; (2)ACD/LogD (pH 5.5): 2.58; (3)ACD/LogD (pH 7.4): 2.58; (4)ACD/BCF (pH 5.5): 53.96; (5)ACD/BCF (pH 7.4): 53.96; (6)ACD/KOC (pH 5.5): 604.58; (7)ACD/KOC (pH 7.4): 604.58; (8)#H bond acceptors: 2; (9)Polar Surface Area: 17.82Å2; (10)Index of Refraction: 1.663; (11)Molar Refractivity: 48.69 cm3; (12)Molar Volume: 131.3 cm3; (13)Polarizability: 19.3x10-24cm3; (14)Surface Tension: 46.7 dyne/cm; (15)Enthalpy of Vaporization: 54.21 kJ/mol; (16)Vapour Pressure: 0.000518 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
