| Identification | |
| Name: | 1(2H)-Naphthalenone,6-fluoro-3,4-dihydro- |
| Synonyms: | 6-Fluoro-1-tetralone;6-Fluoro-3,4-dihydro-1(2H)-naphthalenone;6-Fluoro-3,4-dihydro-2H-naphthalen-1-one;6-Fluoro-a-tetralone; |
| CAS: | 703-67-3 |
| Molecular Formula: | C10H9FO |
| Molecular Weight: | 164.18 |
| InChI: | InChI=1/C10H9FO/c11-8-4-5-9-7(6-8)2-1-3-10(9)12/h4-6H,1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.199 g/cm3 |
| Refractive index: | 1.543 |
| Specification: |
The 6-Fluoro-1-tetralone, with the CAS registry number 703-67-3, is also known as 6-Fluoro-3,4-dihydro-2H-naphthalen-1-one. This chemical's molecular formula is C10H9FO and molecular weight is 164.18. Its systematic name is called 6-fluoro-3,4-dihydronaphthalen-1(2H)-one. Physical properties of 6-Fluoro-1-tetralone: (1)ACD/LogP: 1.95; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 63; (6)ACD/BCF (pH 7.4): 63; (7)ACD/KOC (pH 5.5): 673; (8)ACD/KOC (pH 7.4): 673; (9)#H bond acceptors: 1; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 0; (12)Index of Refraction: 1.543; (13)Molar Refractivity: 43.163 cm3; (14)Molar Volume: 136.97 cm3; (15)Surface Tension: 40.303 dyne/cm; (16)Density: 1.199 g/cm3; (17)Flash Point: 102.34 °C; (18)Enthalpy of Vaporization: 50.765 kJ/mol; (19)Boiling Point: 269.514 °C at 760 mmHg; (20)Vapour Pressure: 0.007 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
