| Identification | |
| Name: | Benzenemethanol, a-[nitroso(phenylmethyl)amino]-,1-acetate |
| Synonyms: | Benzenemethanol,a-[nitroso(phenylmethyl)amino]-,acetate (ester) (9CI); NSC 321795 |
| CAS: | 70490-99-2 |
| Molecular Formula: | C16H16 N2 O3 |
| Molecular Weight: | 284.34 |
| InChI: | InChI=1S/C16H16N2O3/c1-13(19)21-16(15-10-6-3-7-11-15)18(17-20)12-14-8-4-2-5-9-14/h2-11,16H,12H2,1H3 |
| Molecular Structure: | ![(C16H16N2O3) Benzenemethanol,a-[nitroso(phenylmethyl)amino]-,acetate (ester) (9CI); NSC 321795](https://img1.guidechem.com/chem/e/dict/66/70490-99-2.jpg) |
| Properties | |
| Specification: |
N-(alpha-Acetoxybenzyl)-N-benzylnitrosamine (CAS NO.70490-99-2) is also named as Benzenemethanol, alpha-(nitroso(phenylmethyl)amino)-, acetate (ester) ; Dibenzylamine, alpha-acetoxy-N-nitroso- N-Benzyl-N-(alpha-acetoxybenzyl)nitrosamine ; alpha-(Benzylnitrosamino)benzyl alcohol acetate (ester) ; alpha-Acetoxy-N-nitrosodibenzylamine ; Benzyl alcohol, alpha-(benzylnitrosamino)-, acetate (ester) . N-(alpha-Acetoxybenzyl)-N-benzylnitrosamine (CAS NO.70490-99-2) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes by heat. So the storage environment should be ventilate, low-temperature and dry. |
| Safety Data | |
 |
|
