| Identification | |
| Name: | mebenil |
| CAS: | 7055-03-0 |
| EINECS: | 230-334-4 |
| Molecular Formula: | C14H13NO |
| Molecular Weight: | 211.28 |
| InChI: | InChI=1/C14H13NO/c1-11-7-5-6-10-13(11)14(16)15-12-8-3-2-4-9-12/h2-10H,1H3,(H,15,16) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.2°C |
| Boiling Point: | 276.3°C at 760 mmHg |
| Density: | 1.144g/cm3 |
| Refractive index: | 1.629 |
| Specification: |
2-Methyl-N-Phenylbenzamide (CAS NO.7055-03-0) is a colorless crystalline solid. It can soluble in acetone, dimethyl formamide and dimethyl sulfoxide, methanol, ethanol and majority of organic solvents but insoluble in water. React stablity with acid, alkali and thermal. |
| Flash Point: | 162.2°C |
| Safety Data | |
 |
|
