| Identification | |
| Name: | Uridine, 3'-deoxy- |
| Synonyms: | 3'-Deoxyuridine; |
| CAS: | 7057-27-4 |
| Molecular Formula: | C9H12N2O5 |
| Molecular Weight: | 228.202 |
| InChI: | InChI=1/C9H12N2O5/c12-4-5-3-6(13)8(16-5)11-2-1-7(14)10-9(11)15/h1-2,5-6,8,12-13H,3-4H2,(H,10,14,15)/t5-,6+,8+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | 1.533 g/cm3 |
| Refractive index: | 1.603 |
| Appearance: | white solid |
| Specification: | White Solid usageEng:A potential anti-cancer and anti-viral agents |
| Flash Point: | °C |
| Storage Temperature: | Refrigerator |
| Usage: | A potential anti-cancer and anti-viral agents |
| Safety Data | |
 |
|
