| Identification |
| Name: | Meldola blue |
| CAS: | 7057-57-0 |
| EINECS: | 230-338-6 |
| Molecular Formula: | C18H15N2O+ |
| Molecular Weight: | 447.0925 |
| InChI: | InChI=1S/C18H15N2O.3ClH.Zn/c1-20(2)13-8-9-15-17(11-13)21-16-10-7-12-5-3-4-6-14(12)18(16)19-15;;;;/h3-11H,1-2H3;3*1H;/q+1;;;;+2/p-3 |
| Molecular Structure: |
![(C18H15N2O+) benzo[a]phenoxazin-7-ium,9-(dimethylamino)-,chloride,compd.withzincchlori;meldola’s;8-DIMETHYLAMINO...](https://img.guidechem.com/cas/gif/7057-57-0.gif) |
| Properties |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Water Solubility: | Stability Stable. Incompatible with strong oxidizing agents. Toxicology May be harmful or act as an irritant - toxicologynot fully investigated. Toxicity data ( |
| Solubility: | |
| Appearance: | dark green powder |
| Safety Data |
| |
 |
