| Identification |
| Name: | O,O-bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1) |
| Synonyms: | Phosphorodithioic acid, O,O-bis(1-methylpropyl) ester, compd. with N-cyclohexylcyclohexanamine (1:1);O,O-Bis(1-methylpropyl) dithiophosphate, dicyclohexylamine salt;O,O-Bis(sec-butyl) hydrogen dithiophosphate, compound with dicyclohexylamine (1:1);O,O-dibutan-2-yl hydrogen phosphorodithioate - N-cyclohexylcyclohexanamine (1:1) |
| CAS: | 70682-65-4 |
| EINECS: | 274-745-7 |
| Molecular Formula: | C20H42NO2PS2 |
| Molecular Weight: | 423.6567 |
| InChI: | InChI=1/C12H23N.C8H19O2PS2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-5-7(3)9-11(12,13)10-8(4)6-2/h11-13H,1-10H2;7-8H,5-6H2,1-4H3,(H,12,13) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 96.1°C |
| Boiling Point: | 256.1°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 96.1°C |
| Safety Data |
| |
 |
