Identification |
Name: | 1,4-Benzenedicarboxylic acid, dimethyl ester, manuf. of, by-products from, polymers with diethylene glycol |
Synonyms: | 1,4-Benzenedicarboxylic acid, dimethyl ester, manuf. of, by-products from, polymers with diethylene glycol |
CAS: | 70749-97-2 |
Molecular Formula: | C14H20O7 |
Molecular Weight: | 0 |
InChI: | InChI=1/C10H10O4.C4H10O3/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2;5-1-3-7-4-2-6/h3-6H,1-2H3;5-6H,1-4H2 |
Molecular Structure: |
 |
Properties |
Flash Point: | 148°C |
Boiling Point: | 285°C at 760 mmHg |
Flash Point: | 148°C |
Safety Data |
|
 |