| Identification |
| Name: | Ethanol, 2,2'-oxybis-, reaction products with 1,1'-methylenebis[4-isocyanatocyclohexane] and TDI |
| Synonyms: | Ethanol, 2,2'-oxybis-, reaction products with 1,1'-methylenebis(4-isocyanatocyclohexane) and TDI;1,3-diisocyanato-2-methyl-benzene; 2-(2-hydroxyethoxy)ethanol; 1-isocyanato-4-[(4-isocyanatocyclohexyl)methyl]cyclohexane |
| CAS: | 70750-06-0 |
| EINECS: | 274-837-7 |
| Molecular Formula: | C28H38N4O7 |
| Molecular Weight: | 542.6239 |
| InChI: | InChI=1/C15H22N2O2.C9H6N2O2.C4H10O3/c18-10-16-14-5-1-12(2-6-14)9-13-3-7-15(8-4-13)17-11-19;1-7-8(10-5-12)3-2-4-9(7)11-6-13;5-1-3-7-4-2-6/h12-15H,1-9H2;2-4H,1H3;5-6H,1-4H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 149.8°C |
| Boiling Point: | 363.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 149.8°C |
| Safety Data |
| |
 |
