| Identification | |
| Name: | N,N-Diisopropylethylamine |
| Synonyms: | Huenigs base; N-Ethyldiisopropylamine; DIEA; H(u:nigs Base; DIPEA; DIEA/NMP (2.0M; DIPEA; Diisopropyl triethylamine |
| CAS: | 7087-68-5 |
| EINECS: | 230-392-0 |
| Molecular Formula: | C8H19N |
| Molecular Weight: | 129.24 |
| InChI: | InChI=1/C8H19N/c1-6-9(7(2)3)8(4)5/h7-8H,6H2,1-5H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1993/2733 |
| Density: | 0.782 |
| Stability: | No data. |
| Refractive index: | 1.4123-1.4143 |
| Water Solubility: | miscible |
| Solubility: | miscible in water |
| Appearance: | clear, colorless to light yellow liquid |
| Specification: |
Ethyldiisopropylamine , its cas register number is 7087-68-5. It also can be called N,N-Diisopropylethylamine ; N-Ethyldiisopropylamine ; Huenig's base ; DIEA ; EDIA .It is a clear, colorless to light yellow liquid. |
| Packinggroup: | II |
| HS Code: | 29211980 |
| Storage Temperature: | Store in dark! |
| Safety Data | |
| Hazard Symbols |
F:Flammable
C:Corrosive
|
 |
|
