| Identification | |
| Name: | Benzaldehyde,2-propoxy- |
| Synonyms: | Benzaldehyde,o-propoxy- (6CI,7CI,8CI);2-Propoxybenzaldehyde;NSC 68512;o-Propoxybenzaldehyde; |
| CAS: | 7091-12-5 |
| Molecular Formula: | C10H12O2 |
| Molecular Weight: | 164.2 |
| InChI: | InChI=1/C10H12O2/c1-2-7-12-10-6-4-3-5-9(10)8-11/h3-6,8H,2,7H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 113.2°C |
| Boiling Point: | 264.6°Cat760mmHg |
| Density: | 1.038g/cm3 |
| Refractive index: | 1.531 |
| Specification: |
The 2-Propyloxybenzaldehyde with the cas number 7091-12-5 is also called Benzaldehyde,2-propoxy-. Its molecular formula is C10H12O2. The product's category is Benzaldehyde. This chemical is sensitive to air. It is irritant. While using this chemical, you should be very cautious. The properties of the chemical are: (1)ACD/LogP: 2.78; (2)# of Rule of 5 Violations: 0 ; (3)#H bond acceptors: 2; (4)#H bond donors: 0; (5)#Freely Rotating Bonds: 4; (6)Polar Surface Area: 26.3Å2; (7)Index of Refraction: 1.531; (8)Molar Refractivity: 48.94 cm3; (9)Molar Volume: 158.1 cm3; (10)Polarizability: 19.4×10-24cm3; (11)Surface Tension: 36.4 dyne/cm; (12)Enthalpy of Vaporization: 50.25 kJ/mol; (13)Vapour Pressure: 0.00963 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Flash Point: | 113.2°C |
| Sensitive: | Air Sensitive |
| Safety Data | |
 |
|
