| Identification | |
| Name: | 1H-Cyclopenta[k]benz[a]anthracene,2,3-dihydro- |
| Synonyms: | 1H-Benzo[a]cyclopent[h]anthracene,2,3-dihydro- (6CI,8CI,9CI); 2,3-Dihydro-1H-benzo[a]cyclopent[h]anthracene |
| CAS: | 7099-43-6 |
| Molecular Formula: | C21H16 |
| Molecular Weight: | 270.39 |
| InChI: | InChI=1/C21H16/c1-2-6-18-14(4-1)8-10-16-13-21-17(12-20(16)18)11-9-15-5-3-7-19(15)21/h1-2,4,6,8-13H,3,5,7H2 |
| Molecular Structure: | ![(C21H16) 1H-Benzo[a]cyclopent[h]anthracene,2,3-dihydro- (6CI,8CI,9CI); 2,3-Dihydro-1H-benzo[a]cyclopent[h]ant...](https://img1.guidechem.com/chem/e/dict/38/7099-43-6.jpg) |
| Properties | |
| Flash Point: | 247°C |
| Boiling Point: | 496.1°C at 760 mmHg |
| Density: | 1.214g/cm3 |
| Refractive index: | 1.771 |
| Specification: |
5:6-Cyclopenteno-1:2-benzanthracene ,with CAS number of 7099-43-6,can be called 2,3-Dihydro-1H-benzo(a)cyclopent(b)anthracene . |
| Report: |
5:6-Cyclopenteno-1:2-benzanthracene (CAS NO.7099-43-6) was reported in PRLBA4 Proceedings of the Royal Society of London, Series B: Biological Sciences. |
| Flash Point: | 247°C |
| Safety Data | |
 |
|
