| Identification | |
| Name: | L-Histidine |
| Synonyms: | L-Histidine,free base; L-HIS = H-His-OH; (S)-2-Amino-3-(4-imidazolyl)propionic acid~H-His-OH; L-Histidine Base; H-His-OH; His |
| CAS: | 71-00-1 |
| EINECS: | 200-745-3 |
| Molecular Formula: | C6H9N3O2 |
| Molecular Weight: | 155.16 |
| InChI: | InChI=1/C6H9N3O2/c7-5(6(10)11)1-4-2-8-3-9-4/h2-3,5H,1,7H2,(H,8,9)(H,10,11)/t5-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Flash Point: | 282oC |
| Boiling Point: | 458.9oC at 760 mmHg |
| Density: | 1.423 g/cm3 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.731 |
| Alpha: | 12.4 o (C=11,6N HCL) |
| Solubility: | soluble |
| Appearance: | white crystals |
| Specification: | White crystalline powder Safety Statements:24/25-36/37-26-22 24/25:Avoid contact with skin and eyes 36/37:Wear suitable protective clothing and gloves 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 22:Do not breathe dust |
| Report: |
Reported in EPA TSCA Inventory. |
| HS Code: | 29332990 |
| Flash Point: | 282oC |
| Storage Temperature: | Store at RT. |
| Color: | Needles or plates COLORLESS |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
