| Identification | |
| Name: | Cytosine |
| Synonyms: | 4-Amino-2-hydroxypyrimidine; 4-Amino-2-oxo-1,2-dihydropyrimidine |
| CAS: | 71-30-7 |
| EINECS: | 200-749-5 |
| Molecular Formula: | C4H5N3O |
| Molecular Weight: | 111.1 |
| InChI: | InChI=1/C4H5N3O/c5-3-1-2-6-4(8)7-3/h1-2H,(H3,5,6,7,8) |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Density: | 0.48 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Refractive index: | 1.688 |
| Water Solubility: | soluble |
| Solubility: | soluble in water |
| Appearance: | white solid |
| Specification: |
?Cytosine (CAS NO.71-30-7) is also named as 4-Amino-2(1H)-pyrimidinone ; 4-Amino-2-hydroxypyrimidine ; AI3-52281 ; Cyt ; Cytosinimine ; NSC 27787?; 2(1H)-Pyrimidinone, 4-amino- .?Cytosine (CAS NO.71-30-7) is white solid. |
| Storage Temperature: | Store at RT. |
| Usage: | Widely distributed in nature; constituent of nucleic acids |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
