| Identification | |
| Name: | 1H-2-Benzoxacyclotetradecin-1-one,3,4,5,6,7,8,9,10-octahydro-7,14,16-trihydroxy-3-methyl-, (3S,7S,11E)- |
| Synonyms: | 1H-2-Benzoxacyclotetradecin-1-one,3,4,5,6,7,8,9,10-octahydro-7,14,16-trihydroxy-3-methyl-, [3S-(3R*,7R*,11E)]-;(-)-b-Zearalenol; b-Zearalenol; b-trans-Zearalenol |
| CAS: | 71030-11-0 |
| Molecular Formula: | C18H24 O5 |
| Molecular Weight: | 320.38 |
| InChI: | InChI=1/C18H24O5/c1-12-6-5-9-14(19)8-4-2-3-7-13-10-15(20)11-16(21)17(13)18(22)23-12/h3,7,10-12,14,19-21H,2,4-6,8-9H2,1H3/b7-3+/t12-,14-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 217.9°C |
| Boiling Point: | 599°C at 760 mmHg |
| Density: | 1.174g/cm3 |
| Refractive index: | 1.548 |
| Specification: | White Solid usageEng:Reactant involved in biological studies including:• ;Synthesis of amino glycoside nucleotides1• ;Enzymatic synthesis of glucuronides of zearalenone2• ;Derivatization of Zearalenone3,4,5 Safety Statements:36/37-61 36/37:Wear suitable protective clothing and gloves 61:Avoid release to the environment. Refer to special instructions safety data sheet |
| Flash Point: | 217.9°C |
| Storage Temperature: | −20°C |
| Usage: | Reactant involved in biological studies including:• ;Synthesis of amino glycoside nucleotides1• ;Enzymatic synthesis of glucuronides of zearalenone2• ;Derivatization of Zearalenone3,4,5 |
| Safety Data | |
 |
|
