Levomepromazine maleate (7104-38-3)

The Levomepromazine maleate with the cas number 7104-38-3 is also called Methotrimeprazine maleate. Thesystematic name is (2R)-3-(2-methoxy-10H-phenothiazin-10-yl)-N,N,2-trimethylpropan-1-amine (2Z)-but-2-enedioate. Its EINECS registry number is 230-412-8. The molecular formula is C₁₉H₂₄N₂OS^.C₄H₄O₄. The classification code of this chemical is Analgesic [central nervous system depressant].

The properties of the chemical are: (1)ACD/LogP: 4.94; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 1.91; (4)ACD/LogD (pH 7.4): 3.04; (5)ACD/BCF (pH 5.5): 3.15; (6)ACD/BCF (pH 7.4): 42.18; (7)ACD/KOC (pH 5.5): 10.94; (8)ACD/KOC (pH 7.4): 146.34; (9)#H bond acceptors: 3; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 41.01 Å²; (13)Enthalpy of Vaporization: 73.01 kJ/mol; (14)Vapour Pressure: 6.22×10^-9 mmHg at 25°C.

You can still convert the following datas into molecular structure:
(1)SMILES: O=C(O)\C=C/C(=O)O.O(c2cc1N(c3c(Sc1cc2)cccc3)C[C@H](C)CN(C)C)C
(2)InChI: InChI=1/C19H24N2OS.C4H4O4/c1-14(12-20(2)3)13-21-16-7-5-6-8-18(16)23-19-10-9-15(22-4)11-17(19)21;5-3(6)1-2-4(7)8/h5-11,14H,12-13H2,1-4H3;1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-;/m1./s1
(3)InChIKey: IFLZPECPTYCEBR-VIEYUMQNBE