| Identification | |
| Name: | fondaren |
| CAS: | 7122-04-5 |
| Molecular Formula: | C13H17NO4 |
| Molecular Weight: | 251.28 |
| InChI: | InChI=1S/C13H17NO4/c1-8-9(2)17-12(16-8)10-6-4-5-7-11(10)18-13(15)14-3/h4-9,12H,1-3H3,(H,14,15) |
| Molecular Structure: |  |
| Properties | |
| Specification: |
2-(4,5-Dimethyl-1,3-dioxolan-2-yl)phenyl-N-methylcarbamate (CAS NO.7122-04-5) is a kind of highly toxic pesticides ,burning will produce toxic nitrogen oxide gases.Required ventilation, low-temperature drying preservation; and food storage and transportation of raw materials separately.It can be dealt with dry powder, foam, sand, fire extinguishing agent. |
| Safety Data | |
 |
|
