Identification |
Name: | 1,2,4-Benzenetricarboxylic acid, ester with 1,2-ethanediol |
Synonyms: | Ethylene glycol and trimellitic anhydride ester;Ethylene glycol trimellitate;Trimellitic anhydride, ethylene glycol reaction product;benzene-1,2,4-tricarboxylic acid - ethane-1,2-diol (1:1) |
CAS: | 71342-70-6 |
EINECS: | 275-346-0 |
Molecular Formula: | C11H12O8 |
Molecular Weight: | 272.2082 |
InChI: | InChI=1/C9H6O6.C2H6O2/c10-7(11)4-1-2-5(8(12)13)6(3-4)9(14)15;3-1-2-4/h1-3H,(H,10,11)(H,12,13)(H,14,15);3-4H,1-2H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 273.6°C |
Boiling Point: | 505.5°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 273.6°C |
Safety Data |
|
|