| Identification | |
| Name: | 2,8-Dinitrodibenzo-p-dioxin |
| Synonyms: | 2,8-Dinitrooxanthrene;dibenzo[b,e][1,4]dioxin, 2,8-dinitro- |
| CAS: | 71400-34-5 |
| Molecular Formula: | C12H6N2O6 |
| Molecular Weight: | 274.1858 |
| InChI: | InChI=1/C12H6N2O6/c15-13(16)7-1-3-9-11(5-7)20-12-6-8(14(17)18)2-4-10(12)19-9/h1-6H |
| Molecular Structure: | ![(C12H6N2O6) 2,8-Dinitrooxanthrene;dibenzo[b,e][1,4]dioxin, 2,8-dinitro-](https://img.guidechem.com/crawlimg/71400-34-5.png) |
| Properties | |
| Flash Point: | 214°C |
| Boiling Point: | 445.2°C at 760 mmHg |
| Density: | 1.595g/cm3 |
| Refractive index: | 1.687 |
| Specification: |
2,8-Dinitrodibenzo-p-dioxin ,its cas register number is 71400-34-5. It also can be called Dibenzo(b,e)(1,4)dioxin, 2,8-dinitro- ; and 2,8-Dinitrodibenzo(b,e)(1,4)dioxin . |
| Flash Point: | 214°C |
| Safety Data | |
 |
|
