Identification |
Name: | Butanoic acid,2-[ethyl(1-oxobutyl)amino]ethyl ester |
Synonyms: | Butyricacid, ester with N-ethyl-N-(2-hydroxyethyl)butyramide (8CI); NSC 57331 |
CAS: | 7144-74-3 |
Molecular Formula: | C12H23 N O3 |
Molecular Weight: | 229.3159 |
InChI: | InChI=1/C12H23NO3/c1-4-7-11(14)13(6-3)9-10-16-12(15)8-5-2/h4-10H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 153.1°C |
Boiling Point: | 329.6°C at 760 mmHg |
Density: | 0.978g/cm3 |
Refractive index: | 1.451 |
Flash Point: | 153.1°C |
Safety Data |
|
 |