| Identification | |
| Name: | 2-Furancarboxaldehyde,5-(4-nitrophenyl)- |
| Synonyms: | 2-Furaldehyde,5-(p-nitrophenyl)- (6CI,8CI);5-(4-Nitrophenyl)-2-furancarboxaldehyde;5-(4-Nitrophenyl)furfural;5-(4-Nitrophenyl)furfuraldehyde;5-(p-Nitrophenyl)-2-furaldehyde;5-(p-Nitrophenyl)-2-furancarboxaldehyde;5-(p-Nitrophenyl)furfural;NSC 31431; |
| CAS: | 7147-77-5 |
| EINECS: | 230-459-4 |
| Molecular Formula: | C11H7NO4 |
| Molecular Weight: | 217.18 |
| InChI: | InChI=1/C11H7NO4/c13-7-10-5-6-11(16-10)8-1-3-9(4-2-8)12(14)15/h1-7H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 199.9 ºC |
| Boiling Point: | 406.8ºC at 760 mmHg |
| Density: | 1.348 g/cm3 |
| Refractive index: | 1.618 |
| Appearance: | Yellow powder |
| Specification: |
2-Furancarboxaldehyde,5-(4-nitrophenyl)- , with CAS number of 7147-77-5, can be called 5-(p-nitrophenyl)-2-furaldehyde ; 5-(P-nitrophenyl)-2-furancarbaldehyde ; 5-(p-nitrophenyl)furfural . 2-Furancarboxaldehyde,5-(4-nitrophenyl)- (CAS NO.7147-77-5) is a brown crystalline powder. |
| Flash Point: | 199.9 ºC |
| Storage Temperature: | -20?C Freezer, Under Inert Atmosphere |
| Usage: | A furfural nitrophenyl derivative as antibacterial and fungistatic |
| Safety Data | |
| Hazard Symbols |
Xn: Harmful
|
 |
|
