| Identification | |
| Name: | 4-Piperidinemethanamine,1-methyl- |
| Synonyms: | Piperidine,4-(aminomethyl)-1-methyl- (6CI,8CI); (1-Methylpiperidin-4-yl)methanamine;1-(1-Methylpiperidin-4-yl)methanamine; 1-Methyl-4-(aminomethyl)piperidine;4-Aminomethyl-1-methylpiperidine; NSC 72092 |
| CAS: | 7149-42-0 |
| EINECS: | 230-477-2 |
| Molecular Formula: | C7H16 N2 |
| Molecular Weight: | 128.2153 |
| InChI: | InChI=1/C7H16N2/c1-9-4-2-7(6-8)3-5-9/h7H,2-6,8H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2735 |
| Density: | 0.901g/cm3 |
| Refractive index: | 1.468 |
| Specification: |
(1-Methyl-4-piperidinyl)methylamine , with CAS number of 7149-42-0, can be called (1-methyl-4-piperidinyl)methanamine ; 1-(1-Methyl-4-piperidinyl)methanamine ; 1-(1-Methylpiperidin-4-yl)methanamine ; 4-piperidinemethanamine, 1-methyl- . |
| Safety Data | |
| Hazard Symbols |
C: Corrosive
|
 |
|
