| Identification | |
| Name: | 2,3-Naphthalenedicarboxaldehyde |
| Synonyms: | 2,3-Diformylnaphthalene;NSC 72106; Naphthalene-2,3-dicarbaldehyde |
| CAS: | 7149-49-7 |
| Molecular Formula: | C12H8 O2 |
| Molecular Weight: | 184.1907 |
| InChI: | InChI=1/C12H8O2/c13-7-11-5-9-3-1-2-4-10(9)6-12(11)8-14/h1-8H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 131-133 °C(lit.) |
| Flash Point: | 142.5°C |
| Boiling Point: | 380°Cat760mmHg |
| Density: | 1.254g/cm3 |
| Refractive index: | 1.713 |
| Specification: | Yellow Fluffy Crystalline Solid usageEng:A useful reagent for the derivatization of primary amines, amino acids and small peptides Safety Statements:26 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| Flash Point: | 142.5°C |
| Storage Temperature: | 2-8°C |
| Usage: | A useful reagent for the derivatization of primary amines, amino acids and small peptides |
| Safety Data | |
 |
|
