| Identification | |
| Name: | Acetamide,N-(3-chloro-4-methylphenyl)- |
| Synonyms: | p-Acetotoluidide,3'-chloro- (7CI,8CI); 3'-Chloro-4'-acetotoluidide;3'-Chloro-4'-methylacetanilide; 4-(Acetylamino)-2-chlorotoluene; DRC 2698;N-(3-Chloro-4-methylphenyl)acetamide; N-Acetyl-3-chloro-4-methylaniline; NSC72333 |
| CAS: | 7149-79-3 |
| EINECS: | 230-483-5 |
| Molecular Formula: | C9H10 Cl N O |
| Molecular Weight: | 183.63 |
| InChI: | InChI=1/C9H10ClNO/c1-6-3-4-8(5-9(6)10)11-7(2)12/h3-5H,1-2H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Transport: | 2811 |
| Melting Point: | 105-107°C |
| Flash Point: | 155.4°C |
| Boiling Point: | 333.3°Cat760mmHg |
| Density: | 1.218g/cm3 |
| Refractive index: | 1.581 |
| Specification: | Safety Statements:20-36-45-60 20:When using, do not eat or drink 36:Wear suitable protective clothing 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste |
| Report: |
Reported in EPA TSCA Inventory. |
| Packinggroup: | III |
| Flash Point: | 155.4°C |
| Safety Data | |
 |
|
