| Identification | |
| Name: | Di-n-amylphenylphosphine |
| Synonyms: | Dinamylphenylphosphine |
| CAS: | 71501-08-1 |
| EINECS: | 275-541-0 |
| Molecular Formula: | C16H27P |
| Molecular Weight: | 250.36 |
| InChI: | InChI=1/C16H27P/c1-3-5-10-14-17(15-11-6-4-2)16-12-8-7-9-13-16/h7-9,12-13H,3-6,10-11,14-15H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 3278 |
| Boiling Point: | 209-211°C 50mm |
| Specification: | Safety Statements:20-26-36/37-45-60 20:When using, do not eat or drink 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37:Wear suitable protective clothing and gloves 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) 60:This material and/or its container must be disposed of as hazardous waste |
| Packinggroup: | III |
| Safety Data | |
 |
|
