| Identification | |
| Name: | Benzo[b]thiophene-3-methanamine,5-chloro- |
| Synonyms: | ((5-Chlorobenzothien-3-yl)methyl)amine;3-Aminomethyl-5-chlorobenzothiophene;[(5-Chlorobenzo[b]thiophen-3-yl)methyl]amine;1-(5-chloro-1-benzothiophen-3-yl)methanamine;(5-chloro-1-benzothien-3-yl)methylamine;1-(5-Chloro-1-benzothiophen-3-yl)methanamine;benzo[b]thiophene-3-methanamine, 5-chloro-; |
| CAS: | 71625-90-6 |
| Molecular Formula: | C9H8ClNS |
| Molecular Weight: | 197.68 |
| InChI: | InChI=1/C9H8ClNS/c10-7-1-2-9-8(3-7)6(4-11)5-12-9/h1-3,5H,4,11H2 |
| Molecular Structure: | ![(C9H8ClNS) ((5-Chlorobenzothien-3-yl)methyl)amine;3-Aminomethyl-5-chlorobenzothiophene;[(5-Chlorobenzo[b]thioph...](https://img1.guidechem.com/chem/e/dict/23/71625-90-6.jpg) |
| Properties | |
| Transport: | 2735 |
| Flash Point: | 158.7°C |
| Boiling Point: | 160-162°C 2mm |
| Density: | 1.363g/cm3 |
| Refractive index: | 1.696 |
| Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Flash Point: | 158.7°C |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
