| Identification | |
| Name: | 1H-3-Benzazepine-7,8-diol,6-chloro-2,3,4,5-tetrahydro-1-phenyl- |
| Synonyms: | SKF 81297 |
| CAS: | 71636-61-8 |
| Molecular Formula: | C16H16 Cl N O2 |
| Molecular Weight: | 370.67 |
| InChI: | InChI=1/C16H16ClNO2.BrH/c17-15-11-6-7-18-9-13(10-4-2-1-3-5-10)12(11)8-14(19)16(15)20;/h1-5,8,13,18-20H,6-7,9H2;1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 236.4°C |
| Boiling Point: | 467.3°C at 760 mmHg |
| Density: | 1.299 g/cm3 |
| Specification: | Safety Statements:22-26-36 22:Do not breathe dust 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Biological Activity: | Dopamine D 1 -like receptor agonist. Centrally active following systemic administration in vivo . |
| Flash Point: | 236.4°C |
| Color: | gray |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
