| Identification |
| Name: | Benzene,1,3,5-tris(1-methylethyl)- |
| Synonyms: | Benzene,1,3,5-triisopropyl- (7CI,8CI);1,3,5-Triisopropylbenzene;1,3,5-Tris(1-methylethyl)benzene;1,3,5-Tris(isopropyl)benzene;2,4,6-Triisopropylbenzene;NSC 403075; |
| CAS: | 717-74-8 |
| EINECS: | 211-941-3 |
| Molecular Formula: | C15H24 |
| Molecular Weight: | 204.35 |
| InChI: | InChI=1/C15H24/c1-10(2)13-7-14(11(3)4)9-15(8-13)12(5)6/h7-12H,1-6H3 |
| Molecular Structure: |
 |
| Properties |
| Density: | 0.845 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.4874-1.4894 |
| Water Solubility: | insoluble in water |
| Solubility: | insoluble in water |
| Appearance: | Clear, colorless liquid. |
| HS Code: | 29029080 |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. |
| Safety Data |
| |
 |
