Identification |
Name: | N,N-Di(C16-C18) and C18 unsaturated alkyl ethylene bisamide |
Synonyms: | AC1MHYF4;N,N'-Di(C16-C18) and C18 unsaturated alkyl ethylene bisamide;EINECS 273-277-0;N-[(E)-2-(hexadecanoylamino)ethenyl]hexadecanamide;Amides, C16-18 and C18-unsatd, N,N'-ethylenebis-;Amides, C16-18 and C18-unsatd., N,N'-ethylenebis-;68955-45-3;71808-31-6 |
CAS: | 71808-31-6 |
Molecular Formula: | C34H66N2O2 |
Molecular Weight: | 534.90004 |
InChI: | InChI=1S/C34H66N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-33(37)35-31-32-36-34(38)30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h31-32H,3-30H2,1-2H3,(H,35,37)(H,36,38)/b32-31+ |
Molecular Structure: |
|
Properties |
Flash Point: | 112.5°C |
Boiling Point: | 671.8°Cat760mmHg |
Density: | 0.898g/cm3 |
Flash Point: | 112.5°C |
Safety Data |
|
|