| Identification | |
| Name: | Fluorodinitromethane |
| Synonyms: | Dinitrofluoromethane |
| CAS: | 7182-87-8 |
| Molecular Formula: | CHFN2O4 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/CHFN2O4/c2-1(3(5)6)4(7)8/h1H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 28.2°C |
| Boiling Point: | 123°C at 760 mmHg |
| Density: | 1.622g/cm3 |
| Refractive index: | 1.407 |
| Specification: |
Fluorodinitromethane with cas registry number of 7182-87-8 is also known as Dinitrofluoromethane ; Methane, dinitrofluoro- . It would emit very toxic vapors when heated to decomposition. Fluorodinitromethane with cas registry number of 7182-87-8 is used as a pharmaceutical intermediate . |
| Flash Point: | 28.2°C |
| Safety Data | |
 |
|
