Identification |
Name: | Benzoic acid,3,4,5-trimethoxy-, 4-formyl-2-methoxyphenyl ester |
Synonyms: | Benzoicacid, 3,4,5-trimethoxy-, ester with vanillin (7CI) |
CAS: | 71989-95-2 |
EINECS: | 276-269-5 |
Molecular Formula: | C18H18 O7 |
Molecular Weight: | 346.33 |
InChI: | InChI=1/C18H18O7/c1-21-14-7-11(10-19)5-6-13(14)25-18(20)12-8-15(22-2)17(24-4)16(9-12)23-3/h5-10H,1-4H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 211.8°C |
Boiling Point: | 481.1°C at 760 mmHg |
Density: | 1.234g/cm3 |
Refractive index: | 1.564 |
Flash Point: | 211.8°C |
Safety Data |
|
 |