| Identification | |
| Name: | Dicyclopenta[a,def]phenanthren-6(4H)-one,7,8-dihydro- (9CI) |
| Synonyms: | 15,16-dihydro-1,11-methanocyclopenta(a)phenanthren-17-one |
| CAS: | 72041-34-0 |
| Molecular Formula: | C18H12 O |
| Molecular Weight: | 244.30 |
| InChI: | InChI=1/C18H12O/c19-16-7-6-13-14-5-4-10-2-1-3-11-8-12(9-15(13)16)18(14)17(10)11/h1-5,9H,6-8H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 225.2°C |
| Boiling Point: | 497.1°C at 760 mmHg |
| Density: | 1.381g/cm3 |
| Refractive index: | 1.823 |
| Specification: |
Dicyclopenta(a,def)phenanthren-6(4H)-one, 7,8-dihydro (9CI) , its cas register number is 72041-34-0. It also can be called 15,16-Dihydro-1,11-methanocyclopenta(a)phenanthren-17-one ; 2,3-Dihydrodicyclopenta(c,lmn)phenanthren-1(9H)-one ; CCRIS 2474 . When Dicyclopenta(a,def)phenanthren-6(4H)-one, 7,8-dihydro (9CI) (CAS NO.72041-34-0) is heated to decomposition it emits acrid smoke and irritating fumes. |
| Flash Point: | 225.2°C |
| Safety Data | |
 |
|
