Identification |
Name: | Benzoic acid,4-amino-5-chloro-2-methoxy- |
Synonyms: | o-Anisicacid, 4-amino-5-chloro- (7CI,8CI);2-Methoxy-4-amino-5-chlorobenzoic acid;4-Amino-5-chloro-2-(methyloxy)benzoic acid;4-Amino-5-chloro-o-anisic acid;5-Chloro-4-amino-2-methoxybenzoic acid; |
CAS: | 7206-70-4 |
EINECS: | 230-582-3 |
Molecular Formula: | C8H8ClNO3 |
Molecular Weight: | 201.60 |
InChI: | InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12) |
Molecular Structure: |
|
Properties |
Flash Point: | 177.4°C |
Boiling Point: | 369.7°C at 760 mmHg |
Density: | 1.438 g/cm3 |
Appearance: | white to slightly beige powder |
Specification: | WHITE TO SLIGHTLY BEIGE POWDER usageEng:Metoclopramide (M338685) metabolite. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36:Wear suitable protective clothing |
Flash Point: | 177.4°C |
Storage Temperature: | Refrigerator |
Usage: | Metoclopramide (M338685) metabolite. |
Safety Data |
Hazard Symbols |
Xn:Harmful
|
|
|