| Identification | |
| Name: | Benzoic acid,4-amino-5-chloro-2-methoxy- |
| Synonyms: | o-Anisicacid, 4-amino-5-chloro- (7CI,8CI);2-Methoxy-4-amino-5-chlorobenzoic acid;4-Amino-5-chloro-2-(methyloxy)benzoic acid;4-Amino-5-chloro-o-anisic acid;5-Chloro-4-amino-2-methoxybenzoic acid; |
| CAS: | 7206-70-4 |
| EINECS: | 230-582-3 |
| Molecular Formula: | C8H8ClNO3 |
| Molecular Weight: | 201.60 |
| InChI: | InChI=1/C8H8ClNO3/c1-13-7-3-6(10)5(9)2-4(7)8(11)12/h2-3H,10H2,1H3,(H,11,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 177.4°C |
| Boiling Point: | 369.7°C at 760 mmHg |
| Density: | 1.438 g/cm3 |
| Appearance: | white to slightly beige powder |
| Specification: | WHITE TO SLIGHTLY BEIGE POWDER usageEng:Metoclopramide (M338685) metabolite. Safety Statements:26-36 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36:Wear suitable protective clothing |
| Flash Point: | 177.4°C |
| Storage Temperature: | Refrigerator |
| Usage: | Metoclopramide (M338685) metabolite. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
