| Identification | |
| Name: | D-Phenylalanine,4-ethyl- |
| Synonyms: | (R)-2-AMINO-3-(4-ETHYLPHENYL)PROPANOIC ACID;D-4-Ethylphenylalanine; D-Phenylalanine, 4-ethyl- |
| CAS: | 721385-17-7 |
| Molecular Formula: | C11H15NO2 |
| Molecular Weight: | 241.29 |
| InChI: | InChI=1/C11H15NO2/c1-2-8-3-5-9(6-4-8)7-10(12)11(13)14/h3-6,10H,2,7,12H2,1H3,(H,13,14)/t10-/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 156.7°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | 1.135g/cm3 |
| Refractive index: | 1.559 |
| Specification: |
The (R)-2-Amino-3-(4-ethylphenyl)propanoic acid with cas registry number of 721385-17-7, belongs to the following product categorie: Amino Acid Derivatives. It is also named D-Phenylalanine, 4-ethyl-. Physical properties about this chemical are: You can still convert the following datas into molecular structure: |
| Flash Point: | 156.7°C |
| Safety Data | |
 |
|
