| Identification | |
| Name: | Benzenamine,4,4'-dithiobis- |
| Synonyms: | Aniline,4,4'-dithiodi- (6CI,7CI,8CI);Aniline, p,p'-dithiobis- (3CI);4,4'-Diaminodiphenyl disulfide;4,4'-Diaminophenyl disulfide;4-Aminophenyl disulfide;Bis(4-aminophenyl) disulfide;Bis(p-aniline)disulfide;Dithiobis[4-aminobenzene];NSC 62984;NSC 677451;VTI8;p,p'-Diaminodiphenyl disulfide;p,p'-Dithiobisaniline;p-Aminophenyldisulfide; |
| CAS: | 722-27-0 |
| EINECS: | 211-961-2 |
| Molecular Formula: | C12H12N2S2 |
| Molecular Weight: | 248.38 |
| InChI: | InChI=1/C12H12N2S2/c13-9-1-5-11(6-2-9)15-16-12-7-3-10(14)4-8-12/h1-8H,13-14H2 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 61694 |
| Melting Point: | 77-78 ºC |
| Flash Point: | 224.2 ºC |
| Boiling Point: | 447 ºC at 760 mmHg |
| Density: | 1.34 g/cm3 |
| Stability: | Stable. Incompatible with acids, acid chlorides, acid anhydrides, chloroformates, strong oxidizing agents. Sensitive to air. |
| Refractive index: | 1.74 |
| Appearance: | yellow powder |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 224.2 ºC |
| Safety Data | |
| Hazard Symbols |
Xi: Irritant
|
 |
|
