| Identification | |
| Name: | 2-[2-(dibutylamino)ethoxy]ethanol; phosphoric acid |
| Synonyms: | Phosphoric acid, C12-15-alkyl esters, compds. with polyethylene glycol mono[2-(dibutylamino)ethyl] ether |
| CAS: | 72207-81-9 |
| Molecular Formula: | C12H30NO6P |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C12H27NO2.H3O4P/c1-3-5-7-13(8-6-4-2)9-11-15-12-10-14;1-5(2,3)4/h14H,3-12H2,1-2H3;(H3,1,2,3,4) |
| Molecular Structure: | ![(C12H30NO6P) Phosphoric acid, C12-15-alkyl esters, compds. with polyethylene glycol mono[2-(dibutylamino)ethyl] e...](https://img1.guidechem.com/chem/e/dict/36/174966.png) |
| Properties | |
| Flash Point: | 139.3°C |
| Boiling Point: | 306.7°C at 760 mmHg |
| Flash Point: | 139.3°C |
| Safety Data | |
 |
|
