| Identification | |
| Name: | (2-Ethoxy-4-formylphenyl) acetate |
| Synonyms: | Benzaldehyde,3-ethoxy-4-hydroxy-, acetate (7CI);4-Acetoxy-3-ethoxybenzaldehyde;Ethylvanillin acetate;Ethyl Vanillin acetate;Benzaldehyde,4-(acetyloxy)-3-ethoxy-; |
| CAS: | 72207-94-4 |
| Molecular Formula: | C11H12O4 |
| Molecular Weight: | 208.212 |
| InChI: | InChI=1/C11H12O4/c1-3-14-11-6-9(7-12)4-5-10(11)15-8(2)13/h4-7H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 131.9°C |
| Boiling Point: | 303.9°C at 760 mmHg |
| Density: | 1.161g/cm3 |
| Refractive index: | 1.533 |
| Specification: |
(2-Ethoxy-4-formylphenyl) acetate with CAS number of 72207-94-4 is also called for Akos b004453 ; 2-Ethoxy-4-formyl-phenyl acetate ; Ethyl vanillin acetate ; 4-(Acetyloxy)-3-ethoxy-benzaldehyd ; 4-Acetoxy-3-ethoxybenzaldehyde ; Benzaldehyde, 4-(acetyloxy)-3-ethoxy- ; 4-(Acetyloxy)-3-ethoxybenzaldehyde . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 131.9°C |
| Safety Data | |
 |
|
