| Identification |
| Name: | 3,4-difluorobenzylamine |
| Synonyms: | 3,4-Difluorobenzyl amine; (3,4-Difluorophenyl)methanamine
; Benzenemethanamine, 3,4-difluoro-
; RARECHEM AL BW 0298
; 3,4-Difluorobenzylamine 99%
; 3,4-Difluorobenzylamine99% ; |
| CAS: | 72235-53-1 |
| EINECS: | 276-503-6 |
| Molecular Formula: | C7H7F2N |
| Molecular Weight: | 143.13 |
| InChI: | InChI=1/C7H7F2N/c8-6-2-1-5(4-10)3-7(6)9/h1-3H,4,10H2 |
| Molecular Structure: |
 |
| Properties |
| Transport: | UN 2735 |
| Melting Point: | 31 |
| Boiling Point: | 174 |
| Density: | 1.21 |
| Stability: | Stable at room temperature in closed containers under normal storage and handling conditions. |
| Refractive index: | n20/D 1.493(lit.) |
| Appearance: | Almost colorless liquid. |
| Packinggroup: | III |
| Storage Temperature: | Keep away from heat, sparks, and flame. Keep away from sources of ignition. Keep container closed when not in use. Store in a tightly closed container. Store in a cool, dry, well-ventilated area away from incompatible substances. Corrosives area. |
| Sensitive: | Air Sensitive |
| Safety Data |
| Hazard Symbols |
C:Corrosive
|
| |
 |
