| Identification | |
| Name: | 1H-Indole-2,3-dione,1-phenyl- |
| Synonyms: | Indole-2,3-dione,1-phenyl- (7CI,8CI); Isatin, 1-phenyl- (6CI); 1-Phenyl-2,3-indolinedione;1-Phenylisatin; N-Phenylisatin; NSC 100013 |
| CAS: | 723-89-7 |
| EINECS: | -0 |
| Molecular Formula: | C14H9 N O2 |
| Molecular Weight: | 223.23 |
| InChI: | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 182.6°C |
| Boiling Point: | 388.8°C at 760 mmHg |
| Density: | 1.338g/cm3 |
| Refractive index: | 1.667 |
| Specification: | Safety Statements:27-28-36/37/39-45 27:Take off immediately all contaminated clothing 28:After contact with skin, wash immediately with plenty of ... (to be specified by the manufacturer) 36/37/39:Wear suitable protective clothing, gloves and eye/face protection 45:In case of accident or if you feel unwell, seek medical advice immediately (show label where possible) |
| Flash Point: | 182.6°C |
| Safety Data | |
| Hazard Symbols |
T: Toxic
|
 |
|
