Identification |
Name: | Thiazole,2-bromo-4-methyl- |
Synonyms: | 2-Bromo-4-methylthiazole;2-Bromo-4-methyl-1,3-thiazole; |
CAS: | 7238-61-1 |
Molecular Formula: | C4H4BrNS |
Molecular Weight: | 178.05 |
InChI: | InChI=1/C11H13IN4O3/c12-5-2-16(8-1-6(18)7(3-17)19-8)11-9(5)10(13)14-4-15-11/h2,4,6-8,17-18H,1,3H2,(H2,13,14,15) |
Molecular Structure: |
 |
Properties |
Flash Point: | 71.8 °C |
Boiling Point: | 195.1 °C at 760 mmHg |
Density: | 1.702 g/cm3 |
Refractive index: | 1.881 |
Specification: |
The extinguishing agent of 2-Bromo-4-methylthiazole (CAS NO.7238-61-1) are dry powder, foam, sand, carbon dioxide, water mist.
|
Flash Point: | 71.8 °C |
Sensitive: | Stench |
Safety Data |
Hazard Symbols |
Xi: Irritant
|
|
 |