Identification |
Name: | 1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione,3,4,7a,9,10,10a-hexahydro-5-methoxy-, (7aR,10aS)- |
Synonyms: | 1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione,3,4,7a,9,10,10a-hexahydro-5-methoxy-, (7aR-cis)-;1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione, 3,4,7aa,9,10,10aa-hexahydro-5-methoxy- (8CI);Aflatoxin G2 (7CI); Dihydroaflatoxin G1 |
CAS: | 7241-98-7 |
EINECS: | 230-643-4 |
Molecular Formula: | C17H14 O7 |
Molecular Weight: | 330.31 |
InChI: | InChI=1/C17H14O7/c1-20-9-6-10-12(8-3-5-22-17(8)23-10)14-11(9)7-2-4-21-15(18)13(7)16(19)24-14/h6,8,17H,2-5H2,1H3/t8-,17+/m0/s1 |
Molecular Structure: |
![(C17H14O7) 1H,12H-Furo[3',2':4,5]furo[2,3-h]pyrano[3,4-c][1]benzopyran-1,12-dione,3,4,7a,9,10,10a-hexahydro-5-m...](https://img1.guidechem.com/chem/e/dict/35/7241-98-7.jpg) |
Properties |
Transport: | UN 3462 6 |
Melting Point: | 237-240 °C |
Density: | 1.55 g/cm3 |
Refractive index: | 1.654 |
Packinggroup: | I |
Storage Temperature: | 2-8°C |
Usage: | Aflatoxins B1, B2, G1, G2 as secondary metabolites of fungal species such as Aspergillus flavus or Aspergillus parasiticus growing on a variety of foods (peanuts, nuts, spices, cereals). Aflatoxins are a group of very carcinogenic mycotoxins with hepatot |
Safety Data |
Hazard Symbols |
T+: Very toxic
|
|
 |