| Identification |
| Name: | 2-Furancarboxylic acid,4,5-dihydro-5-methyl-4-oxo-5-phenyl- |
| CAS: | 72420-38-3 |
| Molecular Formula: | C12H10O4 |
| Molecular Weight: | 218.2054 |
| InChI: | InChI=1/C12H10O4/c1-12(8-5-3-2-4-6-8)10(13)7-9(16-12)11(14)15/h2-7H,1H3,(H,14,15) |
| Molecular Structure: |
 |
| Properties |
| Density: | 1.343 g/cm3 |
| Refractive index: | 1.591 |
| Biological Activity: | Hypolipidaemic agent; more potent than nicotinic acid and clofibrate. Full and potent agonist at the human orphan GPCR HM74A/GPR109A and GPR109B (EC 50 values are 1.3? and 4.2 μ M respectively). In vivo, reduces serum triglycerides and circulating LDL-cholesterol without affecting liver weight or liver enzymes. |
| Safety Data |
| |
 |
