Identification |
Name: | 2-Pyrrolidinone,1-(4-methoxybenzoyl)- |
Synonyms: | Ampamet;Draganon;Ro 13-3057;Ro 13-5057/001;Sarpul; |
CAS: | 72432-10-1 |
Molecular Formula: | C12H13NO3 |
Molecular Weight: | 219.24 |
InChI: | InChI=1/C12H13NO3/c1-16-10-6-4-9(5-7-10)12(15)13-8-2-3-11(13)14/h4-7H,2-3,8H2,1H3 |
Molecular Structure: |
|
Properties |
Melting Point: | 119-122oC |
Flash Point: | 195.5 oC |
Boiling Point: | 399.7oC at 760 mmHg |
Density: | 1.236 g/cm3 |
Stability: | Stable at normal temperatures and pressures. |
Refractive index: | 1.573 |
Solubility: | 3.3 g/L |
Appearance: | White Crystalline or Crystalline Powde |
Biological Activity: | Nootropic, with modulatory actions through allosteric potentiation of AMPA specific receptors, reduction of glutamate receptor desensitization and potentiation of metabotropic glutamate receptor activity. Anxiolytic following systemic administration. |
Flash Point: | 195.5 oC |
Storage Temperature: | Keep container tightly closed. |
Usage: | Cognition enhancer related to Piracetam. Nootropic. |
Safety Data |
|
|