| Identification | |
| Name: | N,N'-Ethylenebis(iodoacetamide) |
| Synonyms: | N,N'-Ethylenebis(2-iodoacetamide);S-25;Acetamide, N,N'-1,2-ethanediylbis[2-iodo-;Acetamide, N,N'-ethylenebis[2-iodo-;Acetamide, N,N'-ethylenebis[iodo-;Ethylenediamine bis(iodoacetamide);Nsc30028;S 35 |
| CAS: | 7250-43-3 |
| Molecular Formula: | C6H10I2N2O2 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C6H10I2N2O2/c7-3-5(11)9-1-2-10-6(12)4-8/h1-4H2,(H,9,11)(H,10,12) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 285.8°C |
| Boiling Point: | 548.9°C at 760 mmHg |
| Density: | 2.235g/cm3 |
| Stability: | Sensitive to Light; Sensitive to Temperature |
| Refractive index: | 1.63 |
| Specification: | White Crystalline Solid usageEng:Used as a probe for the conformational state of the tubulin molecule. It reacts specifically with the sulfhydryl groups in tubulin |
| Flash Point: | 285.8°C |
| Usage: | Used as a probe for the conformational state of the tubulin molecule. It reacts specifically with the sulfhydryl groups in tubulin |
| Safety Data | |
 |
|
