| Identification | |
| Name: | 3-Pyridinecarbonitrile,2-methoxy- |
| Synonyms: | Nicotinonitrile,2-methoxy- (8CI); 3-Cyano-2-methoxypyridine; NSC 73298 |
| CAS: | 7254-34-4 |
| Molecular Formula: | C7H6 N2 O |
| Molecular Weight: | 134.1353 |
| InChI: | InChI=1/C7H6N2O/c1-10-7-6(5-8)3-2-4-9-7/h2-4H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 58-62 ºC |
| Density: | 1.16 g/cm3 |
| Refractive index: | 1.526 |
| Specification: |
3-Pyridinecarbonitrile,2-methoxy- , its cas register number is 7254-34-4. It also can be called 2-Methoxynicotinonitril . When 3-Pyridinecarbonitrile,2-methoxy- (CAS NO.7254-34-4) is heated to decomposition, it emits toxic fumes of NOx. And the storage environment should be cold. |
| Storage Temperature: | Keep Cold |
| Safety Data | |
 |
|
