| Identification | |
| Name: | D-Lysine hydrochloride |
| CAS: | 7274-88-6 |
| EINECS: | 230-691-6 |
| Molecular Formula: | C6H15ClN2O2 |
| Molecular Weight: | 182.65 |
| InChI: | InChI=1/C6H14N2O2.ClH/c7-4-2-1-3-5(8)6(9)10;/h5H,1-4,7-8H2,(H,9,10);1H/t5-;/m1./s1 |
| Molecular Structure: |  |
| Properties | |
| Stability: | Stable under normal shipping and handling conditions. |
| Alpha: | -21 o (C=8, 6N HCL) |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE |
| Appearance: | White powder |
| Specification: |
?D-Lysine hydrochloride , its CAS NO. is 7274-88-6, the synonyms are D-Lysine, monohydrochloride ; Lysine, hydrochloride, D- ; Lysine, monohydrochloride, D- . |
| Report: |
Reported in EPA TSCA Inventory. |
| Storage Temperature: | Store at RT. |
| Color: | Needles from water, hexagonal plates from dilute alcohol Colorless crystals |
| Safety Data | |
 |
|
