Identification |
Name: | Benzenemethanamine,2-(1-piperidinyl)- |
Synonyms: | 1-[2-(Aminomethyl)phenyl]piperidine;2-Piperidinobenzylamine; [2-(Piperidin-1-yl)benzyl]amine |
CAS: | 72752-54-6 |
Molecular Formula: | C12H18 N2 |
Molecular Weight: | 190.28 |
InChI: | InChI=1/C12H18N2/c13-10-11-6-2-3-7-12(11)14-8-4-1-5-9-14/h2-3,6-7H,1,4-5,8-10,13H2 |
Molecular Structure: |
![(C12H18N2) 1-[2-(Aminomethyl)phenyl]piperidine;2-Piperidinobenzylamine; [2-(Piperidin-1-yl)benzyl]amine](https://img1.guidechem.com/chem/e/dict/23/72752-54-6.jpg) |
Properties |
Flash Point: | 135.8°C |
Boiling Point: | 329.5°C at 760 mmHg |
Density: | 1.047g/cm3 |
Refractive index: | 1.568 |
Specification: | Safety Statements:26-36/37/39 26:In case of contact with eyes, rinse immediately with plenty
of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face
protection |
Flash Point: | 135.8°C |
Storage Temperature: | Store under an inert atmosphere |
Safety Data |
Hazard Symbols |
C: Corrosive
|
|
 |