| Identification | |
| Name: | 2-Butenedioic acid(2E)-, 1,4-bis(1-methylethyl) ester |
| Synonyms: | 2-Butenedioicacid (2E)-, bis(1-methylethyl) ester (9CI); 2-Butenedioic acid (E)-,bis(1-methylethyl) ester; Fumaric acid, diisopropyl ester (6CI,7CI,8CI);Diisopropyl fumarate; NSC 70161 |
| CAS: | 7283-70-7 |
| EINECS: | 230-707-1 |
| Molecular Formula: | C10H16 O4 |
| Molecular Weight: | 200.26 |
| InChI: | InChI=1/C10H16O4/c1-7(2)13-9(11)5-6-10(12)14-8(3)4/h5-8H,1-4H3/b6-5+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 112.3°C |
| Boiling Point: | 225.5°C at 760 mmHg |
| Density: | 1.027g/cm3 |
| Refractive index: | 1.445 |
| Specification: |
Diisopropyl fumarate with cas registry number of 7283-70-7 is also known as Fumaricacid,diisopropylester ; (E)-2-Butenedioic acid di(1-methylethyl) ; (E)-2-Butenedioic acid diisopropyl ; Fumaric acid diisopropyl . |
| Flash Point: | 112.3°C |
| Safety Data | |
 |
|
