| Identification | |
| Name: | b-D-Glucopyranosylamine |
| Synonyms: | Glucopyranosylamine(6CI,7CI);Glucopyranosylamine, b-D- (8CI);1-Amino-1-deoxy-b-D-glucopyranose;1-Amino-1-deoxy-b-D-glucose;b-D-Glucosylamine; |
| CAS: | 7284-37-9 |
| Molecular Formula: | C6H13NO5 |
| Molecular Weight: | 179.17 |
| InChI: | InChI=1/C6H13NO5/c7-6-5(11)4(10)3(9)2(1-8)12-6/h2-6,8-11H,1,7H2/t2-,3-,4+,5-,6?/m1/s1 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.563 g/cm3 |
| Refractive index: | 1.6 |
| Specification: |
The cas register number of beta-D-Glucopyranosylamine is 7284-37-9. It also can be called as 1-Amino-1-deoxy-b-D-glucopyranose and the IUPAC Name about this chemical is (2R,3R,4S,5S,6R)-2-amino-6-(hydroxymethyl)oxane-3,4,5-triol. Physical properties about beta-D-Glucopyranosylamine are: (1)ACD/LogP: -1.26; (2)# of Rule of 5 Violations: 1; (3)#H bond acceptors: 6; (4)#H bond donors: 6; (5)#Freely Rotating Bonds: 6; (6)Polar Surface Area: 49.39Å2; (7)Index of Refraction: 1.6; (8)Molar Refractivity: 39.21 cm3; (9)Molar Volume: 114.5 cm3; (10)Polarizability: 15.54x10-24cm3; (11)Surface Tension: 73.8 dyne/cm; (12)Enthalpy of Vaporization: 77.36 kJ/mol; (13)Boiling Point: 416.4 °C at 760 mmHg; (14)Vapour Pressure: 1.12E-08 mmHg at 25°C. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
