Identification |
Name: | heptanal, cyclic acetal with glycerol |
Synonyms: | Heptanal, cyclic acetal with 1,2,3-propanetriol;Heptanal, cyclic acetal with glycerol;1-(heptyloxy)-3-hydroxypropan-2-one |
CAS: | 72854-42-3 |
EINECS: | 276-947-0 |
Molecular Formula: | C10H20O3 |
Molecular Weight: | 188.264 |
InChI: | InChI=1/C10H20O3/c1-2-3-4-5-6-7-13-9-10(12)8-11/h11H,2-9H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 108.7°C |
Boiling Point: | 297.4°C at 760 mmHg |
Density: | 0.967g/cm3 |
Refractive index: | 1.443 |
Flash Point: | 108.7°C |
Safety Data |
|
 |